Products 1176704-22-5
CAS 1176704-22-5 is the registry number for 2,4-Dichloro-3-fluorobenzoyl chloride, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,4-dichloro-3-fluorobenzoyl chloride (CAS 1176704-22-5) is a chemical compound with the molecular formula C7H2Cl3FO and a molecular weight of 227.4 g/mol. IUPAC name: 2,4-dichloro-3-fluorobenzoyl chloride. InChIKey: KGAYTGLVPUVARW-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3FO |
|---|---|
| Molecular weight | 227.4 g/mol |
| IUPAC name | 2,4-dichloro-3-fluorobenzoyl chloride |
| InChIKey | KGAYTGLVPUVARW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)Cl)Cl)F)Cl |
Computed by PubChem (NCBI)