Products 1195962-86-7

CAS 1195962-86-7 is the registry number for 2,4,6-Trichlorobenzoyl fluoride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2,4,6-trichlorobenzoyl fluoride (CAS 1195962-86-7) is a chemical compound with the molecular formula C7H2Cl3FO and a molecular weight of 227.4 g/mol. IUPAC name: 2,4,6-trichlorobenzoyl fluoride. InChIKey: VAKKMDVCJKMUJW-UHFFFAOYSA-N.

Identity
Molecular formulaC7H2Cl3FO
Molecular weight227.4 g/mol
IUPAC name2,4,6-trichlorobenzoyl fluoride
InChIKeyVAKKMDVCJKMUJW-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1Cl)C(=O)F)Cl)Cl

Computed by PubChem (NCBI)