CAS 1195962-86-7 is the registry number for 2,4,6-Trichlorobenzoyl fluoride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,6-trichlorobenzoyl fluoride (CAS 1195962-86-7) is a chemical compound with the molecular formula C7H2Cl3FO and a molecular weight of 227.4 g/mol. IUPAC name: 2,4,6-trichlorobenzoyl fluoride. InChIKey: VAKKMDVCJKMUJW-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3FO |
|---|---|
| Molecular weight | 227.4 g/mol |
| IUPAC name | 2,4,6-trichlorobenzoyl fluoride |
| InChIKey | VAKKMDVCJKMUJW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C(=O)F)Cl)Cl |
Computed by PubChem (NCBI)