CAS 1176744-51-6 appears in our catalog under these names: (E,4E)-4-(4,4-dimethylpent-2-ynylidene)pent-2-ene-1,5-diol, Terbinafine Impurity 32, (2E,4E)-4-(4,4-Dimethylpent-2-yn-1-yl)pent-2-ene-1,5-diol. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(E,4E)-4-(4,4-dimethylpent-2-ynylidene)pent-2-ene-1,5-diol (CAS 1176744-51-6) is a chemical compound with the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. IUPAC name: (E,4E)-4-(4,4-dimethylpent-2-ynylidene)pent-2-ene-1,5-diol. InChIKey: NRQSVEIZZFKKBK-YXJPLFFZSA-N.
| Molecular formula | C12H18O2 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | (E,4E)-4-(4,4-dimethylpent-2-ynylidene)pent-2-ene-1,5-diol |
| InChIKey | NRQSVEIZZFKKBK-YXJPLFFZSA-N |
| SMILES | CC(C)(C)C#C/C=C(/CO)\C=C\CO |
Computed by PubChem (NCBI)