CAS 1177271-06-5 is the registry number for N-(2-Amino-4-bromophenyl)-n,n-dimethylamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
4-bromo-1-N,1-N-dimethylbenzene-1,2-diamine;dihydrochloride (CAS 1177271-06-5) is a chemical compound with the molecular formula C8H13BrCl2N2 and a molecular weight of 288.01 g/mol. IUPAC name: 4-bromo-1-N,1-N-dimethylbenzene-1,2-diamine;dihydrochloride. InChIKey: KWKIGXWQDQNVGU-UHFFFAOYSA-N.
| Molecular formula | C8H13BrCl2N2 |
|---|---|
| Molecular weight | 288.01 g/mol |
| IUPAC name | 4-bromo-1-N,1-N-dimethylbenzene-1,2-diamine;dihydrochloride |
| InChIKey | KWKIGXWQDQNVGU-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)Br)N.Cl.Cl |
Computed by PubChem (NCBI)