CAS 1391575-87-3 is the registry number for (S)–1–(3–Bromophenyl)ethane–1,2–diamine dihydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
(1S)-1-(3-bromophenyl)ethane-1,2-diamine;dihydrochloride (CAS 1391575-87-3) is a chemical compound with the molecular formula C8H13BrCl2N2 and a molecular weight of 288.01 g/mol. IUPAC name: (1S)-1-(3-bromophenyl)ethane-1,2-diamine;dihydrochloride. InChIKey: FGMKRFUZTKAEGI-YCBDHFTFSA-N.
| Molecular formula | C8H13BrCl2N2 |
|---|---|
| Molecular weight | 288.01 g/mol |
| IUPAC name | (1S)-1-(3-bromophenyl)ethane-1,2-diamine;dihydrochloride |
| InChIKey | FGMKRFUZTKAEGI-YCBDHFTFSA-N |
| SMILES | C1=CC(=CC(=C1)Br)[C@@H](CN)N.Cl.Cl |
Computed by PubChem (NCBI)