Products 1177291-38-1
CAS 1177291-38-1 appears in our catalog under these names: 5-Cyclopropyl-1-methyl-pyrazole-3-carboxylic acid, 5-Cyclopropyl-1-methyl-1h-pyrazole-3-carboxylic acid, 95%, 5-Cyclopropyl-1-methyl-1H-pyrazole-3-carboxylic acid, 97%, 5-CYCLOPROPYL-1-METHYL-1H-PYRAZOLE-3-CARBOXYLIC ACID, 98%. Offered by: Biosynth, Combi-blocks, Ambeed, Chemat, BLDpharm. Available pack sizes: 5g, 0,5g, 250mg, 1g, 100mg.
5-cyclopropyl-1-methylpyrazole-3-carboxylic acid (CAS 1177291-38-1) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 5-cyclopropyl-1-methylpyrazole-3-carboxylic acid. InChIKey: FVKZQLNLKVIBIB-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 5-cyclopropyl-1-methylpyrazole-3-carboxylic acid |
| InChIKey | FVKZQLNLKVIBIB-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(=O)O)C2CC2 |
Computed by PubChem (NCBI)