Products 1177349-04-0
CAS 1177349-04-0 is the registry number for 3-Methyl-4-(4-methylpiperazin-1-yl)aniline dihydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
3-methyl-4-(4-methylpiperazin-1-yl)aniline;dihydrochloride (CAS 1177349-04-0) is a chemical compound with the molecular formula C12H21Cl2N3 and a molecular weight of 278.22 g/mol. IUPAC name: 3-methyl-4-(4-methylpiperazin-1-yl)aniline;dihydrochloride. InChIKey: AVLOESLHJWDSDP-UHFFFAOYSA-N.
| Molecular formula | C12H21Cl2N3 |
|---|---|
| Molecular weight | 278.22 g/mol |
| IUPAC name | 3-methyl-4-(4-methylpiperazin-1-yl)aniline;dihydrochloride |
| InChIKey | AVLOESLHJWDSDP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)N2CCN(CC2)C.Cl.Cl |
Computed by PubChem (NCBI)