CAS 1461715-60-5 appears in our catalog under these names: 6-(4,4-Dimethylpiperidin-1-yl)pyridin-3-amine dihydrochloride, 95%, 6-(4,4-Dimethylpiperidin-1-yl)pyridin-3-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-(4,4-dimethylpiperidin-1-yl)pyridin-3-amine;dihydrochloride (CAS 1461715-60-5) is a chemical compound with the molecular formula C12H21Cl2N3 and a molecular weight of 278.22 g/mol. IUPAC name: 6-(4,4-dimethylpiperidin-1-yl)pyridin-3-amine;dihydrochloride. InChIKey: VBDWARUUGSFTPV-UHFFFAOYSA-N.
| Molecular formula | C12H21Cl2N3 |
|---|---|
| Molecular weight | 278.22 g/mol |
| IUPAC name | 6-(4,4-dimethylpiperidin-1-yl)pyridin-3-amine;dihydrochloride |
| InChIKey | VBDWARUUGSFTPV-UHFFFAOYSA-N |
| SMILES | CC1(CCN(CC1)C2=NC=C(C=C2)N)C.Cl.Cl |
Computed by PubChem (NCBI)