CAS 1177350-78-5 appears in our catalog under these names: 2,6-Dichloro-4-fluoro-1,3-benzothiazole, 95%, 2,6-Dichloro-4-fluoro-1,3-benzothiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 100mg.
2,6-dichloro-4-fluoro-1,3-benzothiazole (CAS 1177350-78-5) is a chemical compound with the molecular formula C7H2Cl2FNS and a molecular weight of 222.07 g/mol. IUPAC name: 2,6-dichloro-4-fluoro-1,3-benzothiazole. InChIKey: NFYMYLFQADNUOU-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2FNS |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | 2,6-dichloro-4-fluoro-1,3-benzothiazole |
| InChIKey | NFYMYLFQADNUOU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C2C(=C1F)N=C(S2)Cl)Cl |
Computed by PubChem (NCBI)