CAS 1895912-47-6 is the registry number for 3,4-Dichloro-2-fluorophenylisothiocyanate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-dichloro-3-fluoro-4-isothiocyanatobenzene (CAS 1895912-47-6) is a chemical compound with the molecular formula C7H2Cl2FNS and a molecular weight of 222.07 g/mol. IUPAC name: 1,2-dichloro-3-fluoro-4-isothiocyanatobenzene. InChIKey: BKQUSECQDJWGCO-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2FNS |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | 1,2-dichloro-3-fluoro-4-isothiocyanatobenzene |
| InChIKey | BKQUSECQDJWGCO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N=C=S)F)Cl)Cl |
Computed by PubChem (NCBI)