CAS 1177357-90-2 is the registry number for 2-(4-Fluoro-2,7-dimethyl-1h-indol-3-yl)ethanamine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-(4-fluoro-2,7-dimethyl-1H-indol-3-yl)ethanamine;oxalic acid (CAS 1177357-90-2) is a chemical compound with the molecular formula C14H17FN2O4 and a molecular weight of 296.29 g/mol. IUPAC name: 2-(4-fluoro-2,7-dimethyl-1H-indol-3-yl)ethanamine;oxalic acid. InChIKey: KPKDQCYTCZVPOP-UHFFFAOYSA-N.
| Molecular formula | C14H17FN2O4 |
|---|---|
| Molecular weight | 296.29 g/mol |
| IUPAC name | 2-(4-fluoro-2,7-dimethyl-1H-indol-3-yl)ethanamine;oxalic acid |
| InChIKey | KPKDQCYTCZVPOP-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)F)C(=C(N2)C)CCN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)