Products 733749-63-8
CAS 733749-63-8 is the registry number for Ethyl 1-(3-fluoro-2-nitrophenyl)piperidine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 10g, 1g.
Ethyl 1-(3-fluoro-2-nitrophenyl)piperidine-4-carboxylate (CAS 733749-63-8) is a chemical compound with the molecular formula C14H17FN2O4 and a molecular weight of 296.29 g/mol. IUPAC name: ethyl 1-(3-fluoro-2-nitrophenyl)piperidine-4-carboxylate. InChIKey: GSODYRSSBQFFDD-UHFFFAOYSA-N.
| Molecular formula | C14H17FN2O4 |
|---|---|
| Molecular weight | 296.29 g/mol |
| IUPAC name | ethyl 1-(3-fluoro-2-nitrophenyl)piperidine-4-carboxylate |
| InChIKey | GSODYRSSBQFFDD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(CC1)C2=C(C(=CC=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)