CAS 1177360-68-7 is the registry number for 1-[2-(Trifluoromethyl)benzyl]-3,5-dimethyl-1h-pyrazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
3,5-dimethyl-1-[[2-(trifluoromethyl)phenyl]methyl]pyrazole-4-carboxylic acid (CAS 1177360-68-7) is a chemical compound with the molecular formula C14H13F3N2O2 and a molecular weight of 298.26 g/mol. IUPAC name: 3,5-dimethyl-1-[[2-(trifluoromethyl)phenyl]methyl]pyrazole-4-carboxylic acid. InChIKey: KAVUUWBISZNDMQ-UHFFFAOYSA-N.
| Molecular formula | C14H13F3N2O2 |
|---|---|
| Molecular weight | 298.26 g/mol |
| IUPAC name | 3,5-dimethyl-1-[[2-(trifluoromethyl)phenyl]methyl]pyrazole-4-carboxylic acid |
| InChIKey | KAVUUWBISZNDMQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC2=CC=CC=C2C(F)(F)F)C)C(=O)O |
Computed by PubChem (NCBI)