CAS 864426-78-8 appears in our catalog under these names: 1-Methyl-3-[4-(trifluoromethyl)phenyl]-1h-pyrazole-5-carboxylic acid ethyl ester, 95%, Ethyl 1-methyl-3-(4-(trifluoromethyl)phenyl)-1H-pyrazole-5-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Ethyl 1-methyl-3-[4-(trifluoromethyl)phenyl]pyrazole-5-carboxylate (CAS 864426-78-8) is a chemical compound with the molecular formula C14H13F3N2O2 and a molecular weight of 298.26 g/mol. IUPAC name: ethyl 1-methyl-3-[4-(trifluoromethyl)phenyl]pyrazole-5-carboxylate. InChIKey: OPKGCYUXZNHKCJ-UHFFFAOYSA-N.
| Molecular formula | C14H13F3N2O2 |
|---|---|
| Molecular weight | 298.26 g/mol |
| IUPAC name | ethyl 1-methyl-3-[4-(trifluoromethyl)phenyl]pyrazole-5-carboxylate |
| InChIKey | OPKGCYUXZNHKCJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NN1C)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)