Products 117760-87-9
CAS 117760-87-9 is the registry number for 4,4'-(Pyridine-2,6-diylbis(oxy))dibenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[[6-(4-carboxyphenoxy)-2-pyridinyl]oxy]benzoic acid (CAS 117760-87-9) is a chemical compound with the molecular formula C19H13NO6 and a molecular weight of 351.3 g/mol. IUPAC name: 4-[[6-(4-carboxyphenoxy)-2-pyridinyl]oxy]benzoic acid. InChIKey: UBHQPKMYKDWELO-UHFFFAOYSA-N.
| Molecular formula | C19H13NO6 |
|---|---|
| Molecular weight | 351.3 g/mol |
| IUPAC name | 4-[[6-(4-carboxyphenoxy)-2-pyridinyl]oxy]benzoic acid |
| InChIKey | UBHQPKMYKDWELO-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)OC2=CC=C(C=C2)C(=O)O)OC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)