Products 2448-39-7
CAS 2448-39-7 is the registry number for 6-Aminocoumarin coumarin-3-carboxylic acid salt, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g.
6-aminochromen-2-one;2-oxochromene-3-carboxylic acid (CAS 2448-39-7) is a chemical compound with the molecular formula C19H13NO6 and a molecular weight of 351.3 g/mol. IUPAC name: 6-aminochromen-2-one;2-oxochromene-3-carboxylic acid. InChIKey: JNQXDXADJGHJDK-UHFFFAOYSA-N.
| Molecular formula | C19H13NO6 |
|---|---|
| Molecular weight | 351.3 g/mol |
| IUPAC name | 6-aminochromen-2-one;2-oxochromene-3-carboxylic acid |
| InChIKey | JNQXDXADJGHJDK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=O)O2)C(=O)O.C1=CC2=C(C=CC(=O)O2)C=C1N |
Computed by PubChem (NCBI)