Products 1177651-87-4

CAS 1177651-87-4 is the registry number for 3-[(Piperazine-1-carbonyl)-amino]-propionic acid methyl ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 3-(piperazine-1-carbonylamino)propanoate;hydrochloride (CAS 1177651-87-4) is a chemical compound with the molecular formula C9H18ClN3O3 and a molecular weight of 251.71 g/mol. IUPAC name: methyl 3-(piperazine-1-carbonylamino)propanoate;hydrochloride. InChIKey: LXGVVSHEOYHNHK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18ClN3O3
Molecular weight251.71 g/mol
IUPAC namemethyl 3-(piperazine-1-carbonylamino)propanoate;hydrochloride
InChIKeyLXGVVSHEOYHNHK-UHFFFAOYSA-N
SMILESCOC(=O)CCNC(=O)N1CCNCC1.Cl

Computed by PubChem (NCBI)