CAS 2055839-99-9 appears in our catalog under these names: tert-Butyl 3-amino-3-carbamoylazetidine-1-carboxylate hydrochloride, 95%, tert-Butyl 3-amino-3-carbamoylazetidine-1-carboxylate hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 10g.
Tert-butyl 3-amino-3-carbamoylazetidine-1-carboxylate;hydrochloride (CAS 2055839-99-9) is a chemical compound with the molecular formula C9H18ClN3O3 and a molecular weight of 251.71 g/mol. IUPAC name: tert-butyl 3-amino-3-carbamoylazetidine-1-carboxylate;hydrochloride. InChIKey: SSXQKHPHJTUIOP-UHFFFAOYSA-N.
| Molecular formula | C9H18ClN3O3 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | tert-butyl 3-amino-3-carbamoylazetidine-1-carboxylate;hydrochloride |
| InChIKey | SSXQKHPHJTUIOP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C(=O)N)N.Cl |
Computed by PubChem (NCBI)