Products 117766-00-4

CAS 117766-00-4 is the registry number for Methanesulfonic acid, 1-(ethylamino)-1-(ethylimino)-, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethylamino(ethylimino)methanesulfonic acid (CAS 117766-00-4) is a chemical compound with the molecular formula C5H12N2O3S and a molecular weight of 180.23 g/mol. IUPAC name: ethylamino(ethylimino)methanesulfonic acid. InChIKey: ZFZUWZZXJPJDRB-UHFFFAOYSA-N.

Identity
Molecular formulaC5H12N2O3S
Molecular weight180.23 g/mol
IUPAC nameethylamino(ethylimino)methanesulfonic acid
InChIKeyZFZUWZZXJPJDRB-UHFFFAOYSA-N
SMILESCCNC(=NCC)S(=O)(=O)O

Computed by PubChem (NCBI)