CAS 1178118-95-0 appears in our catalog under these names: 4-(2,5-Dioxopyrrolidin-1-yl)-3-nitrobenzoic acid, 95%, 4-(2,5-Dioxopyrrolidin-1-yl)-3-nitrobenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-(2,5-dioxopyrrolidin-1-yl)-3-nitrobenzoic acid (CAS 1178118-95-0) is a chemical compound with the molecular formula C11H8N2O6 and a molecular weight of 264.19 g/mol. IUPAC name: 4-(2,5-dioxopyrrolidin-1-yl)-3-nitrobenzoic acid. InChIKey: LJVDQTJIIKNHEW-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O6 |
|---|---|
| Molecular weight | 264.19 g/mol |
| IUPAC name | 4-(2,5-dioxopyrrolidin-1-yl)-3-nitrobenzoic acid |
| InChIKey | LJVDQTJIIKNHEW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)C2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)