CAS 15728-05-9 appears in our catalog under these names: 3-(4-Nitro-1,3-dioxo-1,3-dihydro-isoindol-2-yl)-propionic acid, 95%, 3-(4-Nitro-1,3-dioxoisoindolin-2-yl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoic acid (CAS 15728-05-9) is a chemical compound with the molecular formula C11H8N2O6 and a molecular weight of 264.19 g/mol. IUPAC name: 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoic acid. InChIKey: PGIXCCWHKPRJEG-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O6 |
|---|---|
| Molecular weight | 264.19 g/mol |
| IUPAC name | 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoic acid |
| InChIKey | PGIXCCWHKPRJEG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)N(C2=O)CCC(=O)O |
Computed by PubChem (NCBI)