CAS 1178156-30-3 is the registry number for N-((4-Methyl-4H-1,2,4-triazol-3-yl)methyl)-5-nitropyridin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitropyridin-2-amine (CAS 1178156-30-3) is a chemical compound with the molecular formula C9H10N6O2 and a molecular weight of 234.22 g/mol. IUPAC name: N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitropyridin-2-amine. InChIKey: MFUGHUWRPYBUGP-UHFFFAOYSA-N.
| Molecular formula | C9H10N6O2 |
|---|---|
| Molecular weight | 234.22 g/mol |
| IUPAC name | N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitropyridin-2-amine |
| InChIKey | MFUGHUWRPYBUGP-UHFFFAOYSA-N |
| SMILES | CN1C=NN=C1CNC2=NC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)