CAS 1333960-93-2 is the registry number for 1-(3-Methyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-yl)azetidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)azetidine-3-carboxylic acid (CAS 1333960-93-2) is a chemical compound with the molecular formula C9H10N6O2 and a molecular weight of 234.22 g/mol. IUPAC name: 1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)azetidine-3-carboxylic acid. InChIKey: FNFXQUNHEUHSQC-UHFFFAOYSA-N.
| Molecular formula | C9H10N6O2 |
|---|---|
| Molecular weight | 234.22 g/mol |
| IUPAC name | 1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)azetidine-3-carboxylic acid |
| InChIKey | FNFXQUNHEUHSQC-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=NC=N2)N3CC(C3)C(=O)O)N=N1 |
Computed by PubChem (NCBI)