CAS 1178379-42-4 is the registry number for 2-(4-(2,2-Difluoroethanesulfonyl)phenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[4-(2,2-difluoroethylsulfonyl)phenyl]acetic acid (CAS 1178379-42-4) is a chemical compound with the molecular formula C10H10F2O4S and a molecular weight of 264.25 g/mol. IUPAC name: 2-[4-(2,2-difluoroethylsulfonyl)phenyl]acetic acid. InChIKey: JUYTVOCQTRYLDK-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O4S |
|---|---|
| Molecular weight | 264.25 g/mol |
| IUPAC name | 2-[4-(2,2-difluoroethylsulfonyl)phenyl]acetic acid |
| InChIKey | JUYTVOCQTRYLDK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)S(=O)(=O)CC(F)F |
Computed by PubChem (NCBI)