Products 1178379-42-4

CAS 1178379-42-4 is the registry number for 2-(4-(2,2-Difluoroethanesulfonyl)phenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-[4-(2,2-difluoroethylsulfonyl)phenyl]acetic acid (CAS 1178379-42-4) is a chemical compound with the molecular formula C10H10F2O4S and a molecular weight of 264.25 g/mol. IUPAC name: 2-[4-(2,2-difluoroethylsulfonyl)phenyl]acetic acid. InChIKey: JUYTVOCQTRYLDK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10F2O4S
Molecular weight264.25 g/mol
IUPAC name2-[4-(2,2-difluoroethylsulfonyl)phenyl]acetic acid
InChIKeyJUYTVOCQTRYLDK-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CC(=O)O)S(=O)(=O)CC(F)F

Computed by PubChem (NCBI)