CAS 1221722-64-0 appears in our catalog under these names: [4-(Difluoromethane)sulfonylphenyl]methyl acetate, 95%, (4-Difluoromethanesulfonylphenyl)methyl acetate, 95%, (4-Difluoromethanesulfonylphenyl)methyl acetate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
[4-(difluoromethylsulfonyl)phenyl]methyl acetate (CAS 1221722-64-0) is a chemical compound with the molecular formula C10H10F2O4S and a molecular weight of 264.25 g/mol. IUPAC name: [4-(difluoromethylsulfonyl)phenyl]methyl acetate. InChIKey: AOAKJAHFSVUNIN-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O4S |
|---|---|
| Molecular weight | 264.25 g/mol |
| IUPAC name | [4-(difluoromethylsulfonyl)phenyl]methyl acetate |
| InChIKey | AOAKJAHFSVUNIN-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=CC=C(C=C1)S(=O)(=O)C(F)F |
Computed by PubChem (NCBI)