CAS 1178476-14-6 appears in our catalog under these names: 4-(Chloromethyl)-2-(3,5-dichlorophenyl)-1,3-oxazole, 95%, 4-(Chloromethyl)-2-(3,5-dichlorophenyl)-1,3-oxazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-(chloromethyl)-2-(3,5-dichlorophenyl)-1,3-oxazole (CAS 1178476-14-6) is a chemical compound with the molecular formula C10H6Cl3NO and a molecular weight of 262.5 g/mol. IUPAC name: 4-(chloromethyl)-2-(3,5-dichlorophenyl)-1,3-oxazole. InChIKey: SKZIKVWUUDJVCF-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl3NO |
|---|---|
| Molecular weight | 262.5 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(3,5-dichlorophenyl)-1,3-oxazole |
| InChIKey | SKZIKVWUUDJVCF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C2=NC(=CO2)CCl |
Computed by PubChem (NCBI)