CAS 1265883-06-4 is the registry number for 2,4,7-Trichloro-6-methoxyquinoline, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2,4,7-trichloro-6-methoxyquinoline (CAS 1265883-06-4) is a chemical compound with the molecular formula C10H6Cl3NO and a molecular weight of 262.5 g/mol. IUPAC name: 2,4,7-trichloro-6-methoxyquinoline. InChIKey: KCPTUUNZDXNGTB-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl3NO |
|---|---|
| Molecular weight | 262.5 g/mol |
| IUPAC name | 2,4,7-trichloro-6-methoxyquinoline |
| InChIKey | KCPTUUNZDXNGTB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=CC(=N2)Cl)Cl)Cl |
Computed by PubChem (NCBI)