CAS 1178549-16-0 is the registry number for (S)-N-(3,5-Dimethylphenyl)piperidine-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-N-(3,5-dimethylphenyl)piperidine-2-carboxamide (CAS 1178549-16-0) is a chemical compound with the molecular formula C14H20N2O and a molecular weight of 232.32 g/mol. IUPAC name: (2S)-N-(3,5-dimethylphenyl)piperidine-2-carboxamide. InChIKey: SCMFHFHVWYFRRB-ZDUSSCGKSA-N.
| Molecular formula | C14H20N2O |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | (2S)-N-(3,5-dimethylphenyl)piperidine-2-carboxamide |
| InChIKey | SCMFHFHVWYFRRB-ZDUSSCGKSA-N |
| SMILES | CC1=CC(=CC(=C1)NC(=O)[C@@H]2CCCCN2)C |
Computed by PubChem (NCBI)