Products 1178664-94-2
CAS 1178664-94-2 is the registry number for N-(1-(2,5-Difluorophenyl)ethyl)-1-methyl-1H-pyrazol-3-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[1-(2,5-difluorophenyl)ethyl]-1-methylpyrazol-3-amine (CAS 1178664-94-2) is a chemical compound with the molecular formula C12H13F2N3 and a molecular weight of 237.25 g/mol. IUPAC name: N-[1-(2,5-difluorophenyl)ethyl]-1-methylpyrazol-3-amine. InChIKey: HWZLKHJGJMXEGE-UHFFFAOYSA-N.
| Molecular formula | C12H13F2N3 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | N-[1-(2,5-difluorophenyl)ethyl]-1-methylpyrazol-3-amine |
| InChIKey | HWZLKHJGJMXEGE-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC(=C1)F)F)NC2=NN(C=C2)C |
Computed by PubChem (NCBI)