Products 1365271-73-3
CAS 1365271-73-3 is the registry number for 1-Cyclohexyl-6,7-difluoro-1,2,3-benzotriazole, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1-cyclohexyl-6,7-difluorobenzotriazole (CAS 1365271-73-3) is a chemical compound with the molecular formula C12H13F2N3 and a molecular weight of 237.25 g/mol. IUPAC name: 1-cyclohexyl-6,7-difluorobenzotriazole. InChIKey: YUONRARSLNXSMC-UHFFFAOYSA-N.
| Molecular formula | C12H13F2N3 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 1-cyclohexyl-6,7-difluorobenzotriazole |
| InChIKey | YUONRARSLNXSMC-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N2C3=C(C=CC(=C3F)F)N=N2 |
Computed by PubChem (NCBI)