Products 1178668-74-0
CAS 1178668-74-0 is the registry number for (4-Bromophenyl)(4-(pyrrolidin-1-yl)piperidin-1-yl)methanone, 95%. Offered by: Ambeed. Available pack sizes: 1g, 5g, 10g.
(4-bromophenyl)-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone (CAS 1178668-74-0) is a chemical compound with the molecular formula C16H21BrN2O and a molecular weight of 337.25 g/mol. IUPAC name: (4-bromophenyl)-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone. InChIKey: WMPTXERVFICGDJ-UHFFFAOYSA-N.
| Molecular formula | C16H21BrN2O |
|---|---|
| Molecular weight | 337.25 g/mol |
| IUPAC name | (4-bromophenyl)-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
| InChIKey | WMPTXERVFICGDJ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2CCN(CC2)C(=O)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)