Products 2058319-88-1
CAS 2058319-88-1 is the registry number for 5-Bromo-2-(2,2,6,6-tetramethylpiperidin-4-yloxy)benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-bromo-2-(2,2,6,6-tetramethylpiperidin-4-yl)oxybenzonitrile (CAS 2058319-88-1) is a chemical compound with the molecular formula C16H21BrN2O and a molecular weight of 337.25 g/mol. IUPAC name: 5-bromo-2-(2,2,6,6-tetramethylpiperidin-4-yl)oxybenzonitrile. InChIKey: ZDOQFFGQZFRCPQ-UHFFFAOYSA-N.
| Molecular formula | C16H21BrN2O |
|---|---|
| Molecular weight | 337.25 g/mol |
| IUPAC name | 5-bromo-2-(2,2,6,6-tetramethylpiperidin-4-yl)oxybenzonitrile |
| InChIKey | ZDOQFFGQZFRCPQ-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1)(C)C)OC2=C(C=C(C=C2)Br)C#N)C |
Computed by PubChem (NCBI)