CAS 1178765-70-2 appears in our catalog under these names: 2-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2-methylpropanoic acid, 2-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2-methylpropanoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 2,5g, 250mg, 5g.
2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropanoic acid (CAS 1178765-70-2) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropanoic acid. InChIKey: CPIAGHCCEIMGAL-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropanoic acid |
| InChIKey | CPIAGHCCEIMGAL-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC2=C(C=C1)OCCO2)C(=O)O |
Computed by PubChem (NCBI)