CAS 117879-59-1 is the registry number for 2H-​1,​2,​4-​Benzothiadiazine-​3-​methanamine 1,​1-​dioxide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)methanamine;hydrochloride (CAS 117879-59-1) is a chemical compound with the molecular formula C8H10ClN3O2S and a molecular weight of 247.70 g/mol. IUPAC name: (1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)methanamine;hydrochloride. InChIKey: ZNBHMQOYRDPHFP-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3O2S |
|---|---|
| Molecular weight | 247.70 g/mol |
| IUPAC name | (1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)methanamine;hydrochloride |
| InChIKey | ZNBHMQOYRDPHFP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=NS2(=O)=O)CN.Cl |
Computed by PubChem (NCBI)