CAS 1289388-38-0 is the registry number for 6–Chloro–N–cyclopropyl–2–(methylsulfonyl)pyrimidin–4–amine. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
6-chloro-N-cyclopropyl-2-methylsulfonylpyrimidin-4-amine (CAS 1289388-38-0) is a chemical compound with the molecular formula C8H10ClN3O2S and a molecular weight of 247.70 g/mol. IUPAC name: 6-chloro-N-cyclopropyl-2-methylsulfonylpyrimidin-4-amine. InChIKey: JBYMPSWTDHJVFO-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3O2S |
|---|---|
| Molecular weight | 247.70 g/mol |
| IUPAC name | 6-chloro-N-cyclopropyl-2-methylsulfonylpyrimidin-4-amine |
| InChIKey | JBYMPSWTDHJVFO-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC(=CC(=N1)Cl)NC2CC2 |
Computed by PubChem (NCBI)