Products 1179047-05-2

CAS 1179047-05-2 appears in our catalog under these names: (5-Chloro-2-methoxyphenyl)methanesulfonyl chloride, (5-Chloro-2-methoxyphenyl)methanesulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.

(5-chloro-2-methoxyphenyl)methanesulfonyl chloride (CAS 1179047-05-2) is a chemical compound with the molecular formula C8H8Cl2O3S and a molecular weight of 255.12 g/mol. IUPAC name: (5-chloro-2-methoxyphenyl)methanesulfonyl chloride. InChIKey: RBXYTWGJFABQSQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8Cl2O3S
Molecular weight255.12 g/mol
IUPAC name(5-chloro-2-methoxyphenyl)methanesulfonyl chloride
InChIKeyRBXYTWGJFABQSQ-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)Cl)CS(=O)(=O)Cl

Computed by PubChem (NCBI)