Products 2385031-64-9

CAS 2385031-64-9 is the registry number for 3-Chloro-4-methoxy-2-methylbenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-chloro-4-methoxy-2-methylbenzenesulfonyl chloride (CAS 2385031-64-9) is a chemical compound with the molecular formula C8H8Cl2O3S and a molecular weight of 255.12 g/mol. IUPAC name: 3-chloro-4-methoxy-2-methylbenzenesulfonyl chloride. InChIKey: GOVDBVLXAILRIH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8Cl2O3S
Molecular weight255.12 g/mol
IUPAC name3-chloro-4-methoxy-2-methylbenzenesulfonyl chloride
InChIKeyGOVDBVLXAILRIH-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1Cl)OC)S(=O)(=O)Cl

Computed by PubChem (NCBI)