Products 1179149-10-0
CAS 1179149-10-0 appears in our catalog under these names: 3-Chloroisoquinoline-1-carboxylic acid, 3-Chloroisoquinoline-1-carboxylic acid 97%, 3-Chloroisoquinoline-1-Carboxylic Acid, 97%, 97%, 3-CHLOROISOQUINOLINE-1-CARBOXYLIC ACID, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g.
3-chloroisoquinoline-1-carboxylic acid (CAS 1179149-10-0) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 3-chloroisoquinoline-1-carboxylic acid. InChIKey: VASFAEHWRGJUKE-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 3-chloroisoquinoline-1-carboxylic acid |
| InChIKey | VASFAEHWRGJUKE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N=C2C(=O)O)Cl |
Computed by PubChem (NCBI)