Products 1179188-58-9
CAS 1179188-58-9 is the registry number for 5-(2,3-Dihydrobenzofuran-5-yl)thiazol-2-amine, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
5-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazol-2-amine (CAS 1179188-58-9) is a chemical compound with the molecular formula C11H10N2OS and a molecular weight of 218.28 g/mol. IUPAC name: 5-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazol-2-amine. InChIKey: MQTVFMYFKVKCOI-UHFFFAOYSA-N.
| Molecular formula | C11H10N2OS |
|---|---|
| Molecular weight | 218.28 g/mol |
| IUPAC name | 5-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazol-2-amine |
| InChIKey | MQTVFMYFKVKCOI-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)C3=CN=C(S3)N |
Computed by PubChem (NCBI)