CAS 1179507-09-5 appears in our catalog under these names: 1-(4-Bromo-2-(trifluoromethyl)phenyl)-1H-1,2,3-triazole-4-carboxylic Acid, >95% (HPLC), 1-(4-Bromo-2-(trifluoromethyl)phenyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 50mg, 0,5g.
1-[4-bromo-2-(trifluoromethyl)phenyl]triazole-4-carboxylic acid (CAS 1179507-09-5) is a chemical compound with the molecular formula C10H5BrF3N3O2 and a molecular weight of 336.06 g/mol. IUPAC name: 1-[4-bromo-2-(trifluoromethyl)phenyl]triazole-4-carboxylic acid. InChIKey: GQXSTESNVVWXOZ-UHFFFAOYSA-N.
| Molecular formula | C10H5BrF3N3O2 |
|---|---|
| Molecular weight | 336.06 g/mol |
| IUPAC name | 1-[4-bromo-2-(trifluoromethyl)phenyl]triazole-4-carboxylic acid |
| InChIKey | GQXSTESNVVWXOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(F)(F)F)N2C=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)