CAS 1221724-13-5 is the registry number for 1-(4-Bromophenyl)-5-(trifluoromethyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(4-bromophenyl)-5-(trifluoromethyl)triazole-4-carboxylic acid (CAS 1221724-13-5) is a chemical compound with the molecular formula C10H5BrF3N3O2 and a molecular weight of 336.06 g/mol. IUPAC name: 1-(4-bromophenyl)-5-(trifluoromethyl)triazole-4-carboxylic acid. InChIKey: WJYFVXDTZMKXGZ-UHFFFAOYSA-N.
| Molecular formula | C10H5BrF3N3O2 |
|---|---|
| Molecular weight | 336.06 g/mol |
| IUPAC name | 1-(4-bromophenyl)-5-(trifluoromethyl)triazole-4-carboxylic acid |
| InChIKey | WJYFVXDTZMKXGZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=C(N=N2)C(=O)O)C(F)(F)F)Br |
Computed by PubChem (NCBI)