CAS 1179591-56-0 appears in our catalog under these names: 3-(5-(2-Bromo-5-methoxyphenyl)-1,3,4-oxadiazol-2-yl)propanoic acid, 95%, 3-(5-(2-Bromo-5-methoxyphenyl)-1,3,4-oxadiazol-2-yl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-[5-(2-bromo-5-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid (CAS 1179591-56-0) is a chemical compound with the molecular formula C12H11BrN2O4 and a molecular weight of 327.13 g/mol. IUPAC name: 3-[5-(2-bromo-5-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid. InChIKey: BGDPXWTXLOTKLW-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O4 |
|---|---|
| Molecular weight | 327.13 g/mol |
| IUPAC name | 3-[5-(2-bromo-5-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid |
| InChIKey | BGDPXWTXLOTKLW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)Br)C2=NN=C(O2)CCC(=O)O |
Computed by PubChem (NCBI)