CAS 1989492-96-7 is the registry number for Ethyl 3-(3-bromo-4-methoxyphenyl)-1,2,4-oxadiazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-(3-bromo-4-methoxyphenyl)-1,2,4-oxadiazole-5-carboxylate (CAS 1989492-96-7) is a chemical compound with the molecular formula C12H11BrN2O4 and a molecular weight of 327.13 g/mol. IUPAC name: ethyl 3-(3-bromo-4-methoxyphenyl)-1,2,4-oxadiazole-5-carboxylate. InChIKey: KZAOGYRLPOYDIZ-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O4 |
|---|---|
| Molecular weight | 327.13 g/mol |
| IUPAC name | ethyl 3-(3-bromo-4-methoxyphenyl)-1,2,4-oxadiazole-5-carboxylate |
| InChIKey | KZAOGYRLPOYDIZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=NO1)C2=CC(=C(C=C2)OC)Br |
Computed by PubChem (NCBI)