Products 1179797-95-5
CAS 1179797-95-5 appears in our catalog under these names: 4-(5-Fluoro-2-methylphenyl)benzoic acid, 97%, 5'-Fluoro-2'-methyl-(1,1'-biphenyl)-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
4-(5-fluoro-2-methylphenyl)benzoic acid (CAS 1179797-95-5) is a chemical compound with the molecular formula C14H11FO2 and a molecular weight of 230.23 g/mol. IUPAC name: 4-(5-fluoro-2-methylphenyl)benzoic acid. InChIKey: LVAZOVXWXPBULN-UHFFFAOYSA-N.
| Molecular formula | C14H11FO2 |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | 4-(5-fluoro-2-methylphenyl)benzoic acid |
| InChIKey | LVAZOVXWXPBULN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)F)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)