CAS 1179935-12-6 is the registry number for N-Cyclopropyl-4-nitro-2-(trifluoromethyl)aniline, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
N-cyclopropyl-4-nitro-2-(trifluoromethyl)aniline (CAS 1179935-12-6) is a chemical compound with the molecular formula C10H9F3N2O2 and a molecular weight of 246.19 g/mol. IUPAC name: N-cyclopropyl-4-nitro-2-(trifluoromethyl)aniline. InChIKey: FDTIGTKOZJEUPY-UHFFFAOYSA-N.
| Molecular formula | C10H9F3N2O2 |
|---|---|
| Molecular weight | 246.19 g/mol |
| IUPAC name | N-cyclopropyl-4-nitro-2-(trifluoromethyl)aniline |
| InChIKey | FDTIGTKOZJEUPY-UHFFFAOYSA-N |
| SMILES | C1CC1NC2=C(C=C(C=C2)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)