Products 162748-20-1
CAS 162748-20-1 is the registry number for 1-[4-(Trifluoromethoxy)phenyl]tetrahydro-2h-imidazol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-[4-(trifluoromethoxy)phenyl]imidazolidin-2-one (CAS 162748-20-1) is a chemical compound with the molecular formula C10H9F3N2O2 and a molecular weight of 246.19 g/mol. IUPAC name: 1-[4-(trifluoromethoxy)phenyl]imidazolidin-2-one. InChIKey: VXYIJGXRRJDGGE-UHFFFAOYSA-N.
| Molecular formula | C10H9F3N2O2 |
|---|---|
| Molecular weight | 246.19 g/mol |
| IUPAC name | 1-[4-(trifluoromethoxy)phenyl]imidazolidin-2-one |
| InChIKey | VXYIJGXRRJDGGE-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)N1)C2=CC=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)