CAS 1179998-29-8 is the registry number for 7,4'-Dibenzyl daidzein. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg, 100mg, 250mg.
7-phenylmethoxy-3-(4-phenylmethoxyphenyl)chromen-4-one (CAS 1179998-29-8) is a chemical compound with the molecular formula C29H22O4 and a molecular weight of 434.5 g/mol. IUPAC name: 7-phenylmethoxy-3-(4-phenylmethoxyphenyl)chromen-4-one. InChIKey: MVQWSXAAXGFMND-UHFFFAOYSA-N.
| Molecular formula | C29H22O4 |
|---|---|
| Molecular weight | 434.5 g/mol |
| IUPAC name | 7-phenylmethoxy-3-(4-phenylmethoxyphenyl)chromen-4-one |
| InChIKey | MVQWSXAAXGFMND-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C3=COC4=C(C3=O)C=CC(=C4)OCC5=CC=CC=C5 |
Computed by PubChem (NCBI)