Products 1179998-29-8

CAS 1179998-29-8 is the registry number for 7,4'-Dibenzyl daidzein. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

7-phenylmethoxy-3-(4-phenylmethoxyphenyl)chromen-4-one (CAS 1179998-29-8) is a chemical compound with the molecular formula C29H22O4 and a molecular weight of 434.5 g/mol. IUPAC name: 7-phenylmethoxy-3-(4-phenylmethoxyphenyl)chromen-4-one. InChIKey: MVQWSXAAXGFMND-UHFFFAOYSA-N.

Identity
Molecular formulaC29H22O4
Molecular weight434.5 g/mol
IUPAC name7-phenylmethoxy-3-(4-phenylmethoxyphenyl)chromen-4-one
InChIKeyMVQWSXAAXGFMND-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=CC=C(C=C2)C3=COC4=C(C3=O)C=CC(=C4)OCC5=CC=CC=C5

Computed by PubChem (NCBI)