CAS 1217979-48-0 is the registry number for 4,4'-(9,9-Dimethyl-9H-fluorene-2,7-diyl)dibenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[7-(4-carboxyphenyl)-9,9-dimethylfluoren-2-yl]benzoic acid (CAS 1217979-48-0) is a chemical compound with the molecular formula C29H22O4 and a molecular weight of 434.5 g/mol. IUPAC name: 4-[7-(4-carboxyphenyl)-9,9-dimethylfluoren-2-yl]benzoic acid. InChIKey: VCKDVSMFKPVBPU-UHFFFAOYSA-N.
| Molecular formula | C29H22O4 |
|---|---|
| Molecular weight | 434.5 g/mol |
| IUPAC name | 4-[7-(4-carboxyphenyl)-9,9-dimethylfluoren-2-yl]benzoic acid |
| InChIKey | VCKDVSMFKPVBPU-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)C3=CC=C(C=C3)C(=O)O)C4=C1C=C(C=C4)C5=CC=C(C=C5)C(=O)O)C |
Computed by PubChem (NCBI)