CAS 118-03-6 appears in our catalog under these names: 7-Aminonaphthalene-1,3,6-trisulfonic acid 95%, 2-AMINO-3,6,8-NAPHTHALENETRISULFONIC ACID, 95%, 95%, 7-Aminonaphthalene-1,3,6-trisulfonic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 500g, 1000g, 1kg, 10g, 25g.
7-aminonaphthalene-1,3,6-trisulfonic acid (CAS 118-03-6) is a chemical compound with the molecular formula C10H9NO9S3 and a molecular weight of 383.4 g/mol. IUPAC name: 7-aminonaphthalene-1,3,6-trisulfonic acid. InChIKey: GFPQSWFFPRQEHH-UHFFFAOYSA-N.
| Molecular formula | C10H9NO9S3 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | 7-aminonaphthalene-1,3,6-trisulfonic acid |
| InChIKey | GFPQSWFFPRQEHH-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(C(=CC2=C(C=C1S(=O)(=O)O)S(=O)(=O)O)N)S(=O)(=O)O |
Computed by PubChem (NCBI)