CAS 27310-25-4 is the registry number for 7-Aminonaphthalene-1,3,5-trisulfonic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-aminonaphthalene-1,3,5-trisulfonic acid (CAS 27310-25-4) is a chemical compound with the molecular formula C10H9NO9S3 and a molecular weight of 383.4 g/mol. IUPAC name: 7-aminonaphthalene-1,3,5-trisulfonic acid. InChIKey: HKTWHHAJDJCUPC-UHFFFAOYSA-N.
| Molecular formula | C10H9NO9S3 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | 7-aminonaphthalene-1,3,5-trisulfonic acid |
| InChIKey | HKTWHHAJDJCUPC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=CC(=C2)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O)N |
Computed by PubChem (NCBI)